C20H26O11S2 — CID 122607269
1-[4-[2-[4-(2-hydroxy-2-sulfooxyethoxy)phenyl]propan-2-yl]phenoxy]propan-2-yl hydrogen sulfate (PubChem CID 122607269) has the molecular formula C20H26O11S2 and a molecular weight of 506.55 g/mol. Its IUPAC name is 1-[4-[2-[4-(2-hydroxy-2-sulfooxyethoxy)phenyl]propan-2-yl]phenoxy]propan-2-yl hydrogen sulfate.
| Compound Name | 1-[4-[2-[4-(2-hydroxy-2-sulfooxyethoxy)phenyl]propan-2-yl]phenoxy]propan-2-yl hydrogen sulfate |
|---|---|
| PubChem CID | 122607269 |
| Molecular Formula | C20H26O11S2 |
| Molecular Weight | 506.55 g/mol |
| Exact Mass | 506.09 |
| IUPAC Name | 1-[4-[2-[4-(2-hydroxy-2-sulfooxyethoxy)phenyl]propan-2-yl]phenoxy]propan-2-yl hydrogen sulfate |
| SMILES | CC(COc1ccc(C(C)(C)c2ccc(OCC(O)OS(=O)(=O)O)cc2)cc1)OS(=O)(=O)O |
| InChI | InChI=1S/C20H26O11S2/c1-14(30-32(22,23)24)12-28-17-8-4-15(5-9-17)20(2,3)16-6-10-18(11-7-16)29-13-19(21)31-33(25,26)27/h4-11,14,19,21H,12-13H2,1-3H3,(H,22,23,24)(H,25,26,27) |
| InChIKey | FUIWHKJNPSVMIM-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 165.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.55 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|