C22H31BrO2 — CID 58129878
(10'R,13'S)-16'-bromo-3',10',13'-trimethylspiro[1,3-dioxolane-2,17'-3,4,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene] (PubChem CID 58129878) has the molecular formula C22H31BrO2 and a molecular weight of 407.39 g/mol. Its IUPAC name is (10'R,13'S)-16'-bromo-3',10',13'-trimethylspiro[1,3-dioxolane-2,17'-3,4,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene].
| Compound Name | (10'R,13'S)-16'-bromo-3',10',13'-trimethylspiro[1,3-dioxolane-2,17'-3,4,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene] |
|---|---|
| PubChem CID | 58129878 |
| Molecular Formula | C22H31BrO2 |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | (10'R,13'S)-16'-bromo-3',10',13'-trimethylspiro[1,3-dioxolane-2,17'-3,4,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene] |
| SMILES | CC1C=C[C@@]2(C)C(=CCC3C2CC[C@@]2(C)C3CC(Br)C23OCCO3)C1 |
| InChI | InChI=1S/C22H31BrO2/c1-14-6-8-20(2)15(12-14)4-5-16-17(20)7-9-21(3)18(16)13-19(23)22(21)24-10-11-25-22/h4,6,8,14,16-19H,5,7,9-13H2,1-3H3/t14?,16?,17?,18?,19?,20-,21-/m0/s1 |
| InChIKey | YIMSWGWUSLTXRZ-SPZVSZDXSA-N |
| XLogP | 5.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|