C21H26O3 — CID 58129886
(3'R,10'R,13'S)-10',13'-dimethylspiro[1,3-dioxolane-2,17'-3,4,9,11,12,14-hexahydrocyclopenta[a]phenanthrene]-3'-ol (PubChem CID 58129886) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is (3'R,10'R,13'S)-10',13'-dimethylspiro[1,3-dioxolane-2,17'-3,4,9,11,12,14-hexahydrocyclopenta[a]phenanthrene]-3'-ol.
| Compound Name | (3'R,10'R,13'S)-10',13'-dimethylspiro[1,3-dioxolane-2,17'-3,4,9,11,12,14-hexahydrocyclopenta[a]phenanthrene]-3'-ol |
|---|---|
| PubChem CID | 58129886 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | (3'R,10'R,13'S)-10',13'-dimethylspiro[1,3-dioxolane-2,17'-3,4,9,11,12,14-hexahydrocyclopenta[a]phenanthrene]-3'-ol |
| SMILES | C[C@]12C=C[C@H](O)CC1=CC=C1C2CC[C@@]2(C)C1C=CC21OCCO1 |
| InChI | InChI=1S/C21H26O3/c1-19-8-5-15(22)13-14(19)3-4-16-17(19)6-9-20(2)18(16)7-10-21(20)23-11-12-24-21/h3-5,7-8,10,15,17-18,22H,6,9,11-13H2,1-2H3/t15-,17?,18?,19-,20-/m0/s1 |
| InChIKey | WHSDJQGZDPSNBU-SSXGPBTGSA-N |
| XLogP | 3.53 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|