C37H20N6NiO5 — CID 58131064
6-methylidene-1,10-phenanthrolin-5-one;nickel;bis(1,10-phenanthroline-5,6-dione) (PubChem CID 58131064) has the molecular formula C37H20N6NiO5 and a molecular weight of 687.30 g/mol. Its IUPAC name is 6-methylidene-1,10-phenanthrolin-5-one;nickel;bis(1,10-phenanthroline-5,6-dione).
| Compound Name | 6-methylidene-1,10-phenanthrolin-5-one;nickel;bis(1,10-phenanthroline-5,6-dione) |
|---|---|
| PubChem CID | 58131064 |
| Molecular Formula | C37H20N6NiO5 |
| Molecular Weight | 687.30 g/mol |
| Exact Mass | 686.08 |
| IUPAC Name | 6-methylidene-1,10-phenanthrolin-5-one;nickel;bis(1,10-phenanthroline-5,6-dione) |
| SMILES | C=C1C(=O)c2cccnc2-c2ncccc21.O=C1C(=O)c2cccnc2-c2ncccc21.O=C1C(=O)c2cccnc2-c2ncccc21.[Ni] |
| InChI | InChI=1S/C13H8N2O.2C12H6N2O2.Ni/c1-8-9-4-2-6-14-11(9)12-10(13(8)16)5-3-7-15-12;2*15-11-7-3-1-5-13-9(7)10-8(12(11)16)4-2-6-14-10;/h2-7H,1H2;2*1-6H; |
| InChIKey | FMKLQCYNZAQBFW-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 162.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.30 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|