C17H18ClFN2O3 — CID 58134463
2-[2-(4-chloro-3-fluorophenyl)-6-methylpyrimidin-4-yl]oxy-2-ethylbutanoic acid (PubChem CID 58134463) has the molecular formula C17H18ClFN2O3 and a molecular weight of 352.79 g/mol. Its IUPAC name is 2-[2-(4-chloro-3-fluorophenyl)-6-methylpyrimidin-4-yl]oxy-2-ethylbutanoic acid.
| Compound Name | 2-[2-(4-chloro-3-fluorophenyl)-6-methylpyrimidin-4-yl]oxy-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 58134463 |
| Molecular Formula | C17H18ClFN2O3 |
| Molecular Weight | 352.79 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 2-[2-(4-chloro-3-fluorophenyl)-6-methylpyrimidin-4-yl]oxy-2-ethylbutanoic acid |
| SMILES | CCC(CC)(Oc1cc(C)nc(-c2ccc(Cl)c(F)c2)n1)C(=O)O |
| InChI | InChI=1S/C17H18ClFN2O3/c1-4-17(5-2,16(22)23)24-14-8-10(3)20-15(21-14)11-6-7-12(18)13(19)9-11/h6-9H,4-5H2,1-3H3,(H,22,23) |
| InChIKey | YEKLJVZCWBEHEE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.79 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |