C29H33FN4O3 — CID 58134695
11-acetyl-8-amino-6-[3-(3,4-dihydro-2H-quinolin-1-yl)propylamino]-7-fluorospiro[4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-2,1'-cyclopentane]-10-one (PubChem CID 58134695) has the molecular formula C29H33FN4O3 and a molecular weight of 504.61 g/mol. Its IUPAC name is 11-acetyl-8-amino-6-[3-(3,4-dihydro-2H-quinolin-1-yl)propylamino]-7-fluorospiro[4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-2,1'-cyclopentane]-10-one.
| Compound Name | 11-acetyl-8-amino-6-[3-(3,4-dihydro-2H-quinolin-1-yl)propylamino]-7-fluorospiro[4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-2,1'-cyclopentane]-10-one |
|---|---|
| PubChem CID | 58134695 |
| Molecular Formula | C29H33FN4O3 |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | 11-acetyl-8-amino-6-[3-(3,4-dihydro-2H-quinolin-1-yl)propylamino]-7-fluorospiro[4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-2,1'-cyclopentane]-10-one |
| SMILES | CC(=O)c1cn2c3c(c(NCCCN4CCCc5ccccc54)c(F)c(N)c3c1=O)OCC21CCCC1 |
| InChI | InChI=1S/C29H33FN4O3/c1-18(35)20-16-34-26-22(27(20)36)24(31)23(30)25(28(26)37-17-29(34)11-4-5-12-29)32-13-7-15-33-14-6-9-19-8-2-3-10-21(19)33/h2-3,8,10,16,32H,4-7,9,11-15,17,31H2,1H3 |
| InChIKey | RVLRPPZHSGVVBS-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|