C27H35FN4O3 — CID 58135162
2-(4-acetyl-N-[2-[(5-fluoro-1,3-dihydroisoindol-2-yl)-methylamino]-2-oxoethyl]-2-methylanilino)-N-pentylacetamide (PubChem CID 58135162) has the molecular formula C27H35FN4O3 and a molecular weight of 482.60 g/mol. Its IUPAC name is 2-(4-acetyl-N-[2-[(5-fluoro-1,3-dihydroisoindol-2-yl)-methylamino]-2-oxoethyl]-2-methylanilino)-N-pentylacetamide.
| Compound Name | 2-(4-acetyl-N-[2-[(5-fluoro-1,3-dihydroisoindol-2-yl)-methylamino]-2-oxoethyl]-2-methylanilino)-N-pentylacetamide |
|---|---|
| PubChem CID | 58135162 |
| Molecular Formula | C27H35FN4O3 |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | 2-(4-acetyl-N-[2-[(5-fluoro-1,3-dihydroisoindol-2-yl)-methylamino]-2-oxoethyl]-2-methylanilino)-N-pentylacetamide |
| SMILES | CCCCCNC(=O)CN(CC(=O)N(C)N1Cc2ccc(F)cc2C1)c1ccc(C(C)=O)cc1C |
| InChI | InChI=1S/C27H35FN4O3/c1-5-6-7-12-29-26(34)17-31(25-11-9-21(20(3)33)13-19(25)2)18-27(35)30(4)32-15-22-8-10-24(28)14-23(22)16-32/h8-11,13-14H,5-7,12,15-18H2,1-4H3,(H,29,34) |
| InChIKey | AMAPBNAXFCGJMK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|