C26H33N5O2 — CID 58135326
2-(N-[2-[1,3-dihydroisoindol-2-yl(methyl)amino]-2-oxoethyl]-4-isocyano-2-methylanilino)-N-pentylacetamide (PubChem CID 58135326) has the molecular formula C26H33N5O2 and a molecular weight of 447.58 g/mol. Its IUPAC name is 2-(N-[2-[1,3-dihydroisoindol-2-yl(methyl)amino]-2-oxoethyl]-4-isocyano-2-methylanilino)-N-pentylacetamide.
| Compound Name | 2-(N-[2-[1,3-dihydroisoindol-2-yl(methyl)amino]-2-oxoethyl]-4-isocyano-2-methylanilino)-N-pentylacetamide |
|---|---|
| PubChem CID | 58135326 |
| Molecular Formula | C26H33N5O2 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.26 |
| IUPAC Name | 2-(N-[2-[1,3-dihydroisoindol-2-yl(methyl)amino]-2-oxoethyl]-4-isocyano-2-methylanilino)-N-pentylacetamide |
| SMILES | [C-]#[N+]c1ccc(N(CC(=O)NCCCCC)CC(=O)N(C)N2Cc3ccccc3C2)c(C)c1 |
| InChI | InChI=1S/C26H33N5O2/c1-5-6-9-14-28-25(32)18-30(24-13-12-23(27-3)15-20(24)2)19-26(33)29(4)31-16-21-10-7-8-11-22(21)17-31/h7-8,10-13,15H,5-6,9,14,16-19H2,1-2,4H3,(H,28,32) |
| InChIKey | QBGLEGZZSTUGRT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 60.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|