C31H42N6O2 — CID 58135194
2-[[2-[1,3-dihydroisoindol-2-yl(methyl)amino]-2-oxoethyl]-(2-methyl-8,9,10,11-tetrahydro-7H-azepino[1,2-b]indazol-3-yl)amino]-N-pentylacetamide (PubChem CID 58135194) has the molecular formula C31H42N6O2 and a molecular weight of 530.72 g/mol. Its IUPAC name is 2-[[2-[1,3-dihydroisoindol-2-yl(methyl)amino]-2-oxoethyl]-(2-methyl-8,9,10,11-tetrahydro-7H-azepino[1,2-b]indazol-3-yl)amino]-N-pentylacetamide.
| Compound Name | 2-[[2-[1,3-dihydroisoindol-2-yl(methyl)amino]-2-oxoethyl]-(2-methyl-8,9,10,11-tetrahydro-7H-azepino[1,2-b]indazol-3-yl)amino]-N-pentylacetamide |
|---|---|
| PubChem CID | 58135194 |
| Molecular Formula | C31H42N6O2 |
| Molecular Weight | 530.72 g/mol |
| Exact Mass | 530.34 |
| IUPAC Name | 2-[[2-[1,3-dihydroisoindol-2-yl(methyl)amino]-2-oxoethyl]-(2-methyl-8,9,10,11-tetrahydro-7H-azepino[1,2-b]indazol-3-yl)amino]-N-pentylacetamide |
| SMILES | CCCCCNC(=O)CN(CC(=O)N(C)N1Cc2ccccc2C1)c1cc2nn3c(c2cc1C)CCCCC3 |
| InChI | InChI=1S/C31H42N6O2/c1-4-5-10-15-32-30(38)21-35(22-31(39)34(3)36-19-24-12-8-9-13-25(24)20-36)29-18-27-26(17-23(29)2)28-14-7-6-11-16-37(28)33-27/h8-9,12-13,17-18H,4-7,10-11,14-16,19-22H2,1-3H3,(H,32,38) |
| InChIKey | IUWRESLCMVVHBE-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 73.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.72 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|