C27H36N6O2 — CID 58135106
2-[[2-[1,3-dihydroisoindol-2-yl(methyl)amino]-2-oxoethyl]-(1,6-dimethylindazol-5-yl)amino]-N-pentylacetamide (PubChem CID 58135106) has the molecular formula C27H36N6O2 and a molecular weight of 476.63 g/mol. Its IUPAC name is 2-[[2-[1,3-dihydroisoindol-2-yl(methyl)amino]-2-oxoethyl]-(1,6-dimethylindazol-5-yl)amino]-N-pentylacetamide.
| Compound Name | 2-[[2-[1,3-dihydroisoindol-2-yl(methyl)amino]-2-oxoethyl]-(1,6-dimethylindazol-5-yl)amino]-N-pentylacetamide |
|---|---|
| PubChem CID | 58135106 |
| Molecular Formula | C27H36N6O2 |
| Molecular Weight | 476.63 g/mol |
| Exact Mass | 476.29 |
| IUPAC Name | 2-[[2-[1,3-dihydroisoindol-2-yl(methyl)amino]-2-oxoethyl]-(1,6-dimethylindazol-5-yl)amino]-N-pentylacetamide |
| SMILES | CCCCCNC(=O)CN(CC(=O)N(C)N1Cc2ccccc2C1)c1cc2cnn(C)c2cc1C |
| InChI | InChI=1S/C27H36N6O2/c1-5-6-9-12-28-26(34)18-32(24-14-23-15-29-30(3)25(23)13-20(24)2)19-27(35)31(4)33-16-21-10-7-8-11-22(21)17-33/h7-8,10-11,13-15H,5-6,9,12,16-19H2,1-4H3,(H,28,34) |
| InChIKey | NGKQBTWTWFEDAN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 73.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.63 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|