C28H36N4O2 — CID 58135086
2-(N-[2-[2,3-dihydro-1H-inden-2-yl(methyl)amino]-2-oxoethyl]-4-isocyano-2-methylanilino)-N-(4-methylpentyl)acetamide (PubChem CID 58135086) has the molecular formula C28H36N4O2 and a molecular weight of 460.62 g/mol. Its IUPAC name is 2-(N-[2-[2,3-dihydro-1H-inden-2-yl(methyl)amino]-2-oxoethyl]-4-isocyano-2-methylanilino)-N-(4-methylpentyl)acetamide.
| Compound Name | 2-(N-[2-[2,3-dihydro-1H-inden-2-yl(methyl)amino]-2-oxoethyl]-4-isocyano-2-methylanilino)-N-(4-methylpentyl)acetamide |
|---|---|
| PubChem CID | 58135086 |
| Molecular Formula | C28H36N4O2 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | 2-(N-[2-[2,3-dihydro-1H-inden-2-yl(methyl)amino]-2-oxoethyl]-4-isocyano-2-methylanilino)-N-(4-methylpentyl)acetamide |
| SMILES | [C-]#[N+]c1ccc(N(CC(=O)NCCCC(C)C)CC(=O)N(C)C2Cc3ccccc3C2)c(C)c1 |
| InChI | InChI=1S/C28H36N4O2/c1-20(2)9-8-14-30-27(33)18-32(26-13-12-24(29-4)15-21(26)3)19-28(34)31(5)25-16-22-10-6-7-11-23(22)17-25/h6-7,10-13,15,20,25H,8-9,14,16-19H2,1-3,5H3,(H,30,33) |
| InChIKey | LIQUOOFSVYEODO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 57.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|