C29H41N5O3 — CID 158304040
2-(5-isocyano-N-[2-[(5-methoxy-1,3-dihydroisoindol-2-yl)-methylamino]-2-oxoethyl]-2-methylanilino)-N-(4-methylpentyl)acetamide;methane (PubChem CID 158304040) has the molecular formula C29H41N5O3 and a molecular weight of 507.68 g/mol. Its IUPAC name is 2-(5-isocyano-N-[2-[(5-methoxy-1,3-dihydroisoindol-2-yl)-methylamino]-2-oxoethyl]-2-methylanilino)-N-(4-methylpentyl)acetamide;methane.
| Compound Name | 2-(5-isocyano-N-[2-[(5-methoxy-1,3-dihydroisoindol-2-yl)-methylamino]-2-oxoethyl]-2-methylanilino)-N-(4-methylpentyl)acetamide;methane |
|---|---|
| PubChem CID | 158304040 |
| Molecular Formula | C29H41N5O3 |
| Molecular Weight | 507.68 g/mol |
| Exact Mass | 507.32 |
| IUPAC Name | 2-(5-isocyano-N-[2-[(5-methoxy-1,3-dihydroisoindol-2-yl)-methylamino]-2-oxoethyl]-2-methylanilino)-N-(4-methylpentyl)acetamide;methane |
| SMILES | C.[C-]#[N+]c1ccc(C)c(N(CC(=O)NCCCC(C)C)CC(=O)N(C)N2Cc3ccc(OC)cc3C2)c1 |
| InChI | InChI=1S/C28H37N5O3.CH4/c1-20(2)8-7-13-30-27(34)18-32(26-15-24(29-4)11-9-21(26)3)19-28(35)31(5)33-16-22-10-12-25(36-6)14-23(22)17-33;/h9-12,14-15,20H,7-8,13,16-19H2,1-3,5-6H3,(H,30,34);1H4 |
| InChIKey | GMVXMEPLFCAJHM-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 69.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.68 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|