C19H21FN4O2 — CID 58135495
1-[6-(5-fluoro-2-methoxyphenyl)-1H-indazol-3-yl]-3-(2-methylpropyl)urea (PubChem CID 58135495) has the molecular formula C19H21FN4O2 and a molecular weight of 356.40 g/mol. Its IUPAC name is 1-[6-(5-fluoro-2-methoxyphenyl)-1H-indazol-3-yl]-3-(2-methylpropyl)urea.
| Compound Name | 1-[6-(5-fluoro-2-methoxyphenyl)-1H-indazol-3-yl]-3-(2-methylpropyl)urea |
|---|---|
| PubChem CID | 58135495 |
| Molecular Formula | C19H21FN4O2 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 1-[6-(5-fluoro-2-methoxyphenyl)-1H-indazol-3-yl]-3-(2-methylpropyl)urea |
| SMILES | COc1ccc(F)cc1-c1ccc2c(NC(=O)NCC(C)C)n[nH]c2c1 |
| InChI | InChI=1S/C19H21FN4O2/c1-11(2)10-21-19(25)22-18-14-6-4-12(8-16(14)23-24-18)15-9-13(20)5-7-17(15)26-3/h4-9,11H,10H2,1-3H3,(H3,21,22,23,24,25) |
| InChIKey | CNEPUFQAMFFCFF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |