C30H39Br3NPZr- — CID 58140353
carbanide;cyclopentyl-[2,6-di(propan-2-yl)phenyl]imino-diphenyl-λ5-phosphane;tribromozirconium (PubChem CID 58140353) has the molecular formula C30H39Br3NPZr- and a molecular weight of 775.56 g/mol. Its IUPAC name is carbanide;cyclopentyl-[2,6-di(propan-2-yl)phenyl]imino-diphenyl-λ5-phosphane;tribromozirconium.
| Compound Name | carbanide;cyclopentyl-[2,6-di(propan-2-yl)phenyl]imino-diphenyl-λ5-phosphane;tribromozirconium |
|---|---|
| PubChem CID | 58140353 |
| Molecular Formula | C30H39Br3NPZr- |
| Molecular Weight | 775.56 g/mol |
| Exact Mass | 770.94 |
| IUPAC Name | carbanide;cyclopentyl-[2,6-di(propan-2-yl)phenyl]imino-diphenyl-λ5-phosphane;tribromozirconium |
| SMILES | Br[Zr](Br)Br.CC(C)c1cccc(C(C)C)c1N=P(c1ccccc1)(c1ccccc1)C1CCCC1.[CH3-] |
| InChI | InChI=1S/C29H36NP.CH3.3BrH.Zr/c1-22(2)27-20-13-21-28(23(3)4)29(27)30-31(26-18-11-12-19-26,24-14-7-5-8-15-24)25-16-9-6-10-17-25;;;;;/h5-10,13-17,20-23,26H,11-12,18-19H2,1-4H3;1H3;3*1H;/q;-1;;;;+3/p-3 |
| InChIKey | PVAMFPJNBQCNNV-UHFFFAOYSA-K |
| XLogP | 11.34 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.56 |
| LogP ≤ 5 | 11.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|