C66H68N2P2 — CID 139104654
[2,6-di(propan-2-yl)phenyl]imino-(3H-inden-1-yl)-diphenyl-λ5-phosphane (PubChem CID 139104654) has the molecular formula C66H68N2P2 and a molecular weight of 951.23 g/mol. Its IUPAC name is [2,6-di(propan-2-yl)phenyl]imino-(3H-inden-1-yl)-diphenyl-λ5-phosphane.
| Compound Name | [2,6-di(propan-2-yl)phenyl]imino-(3H-inden-1-yl)-diphenyl-λ5-phosphane |
|---|---|
| PubChem CID | 139104654 |
| Molecular Formula | C66H68N2P2 |
| Molecular Weight | 951.23 g/mol |
| Exact Mass | 950.49 |
| IUPAC Name | [2,6-di(propan-2-yl)phenyl]imino-(3H-inden-1-yl)-diphenyl-λ5-phosphane |
| SMILES | CC(C)c1cccc(C(C)C)c1N=P(C1=CCc2ccccc21)(c1ccccc1)c1ccccc1.CC(C)c1cccc(C(C)C)c1N=P(C1=CCc2ccccc21)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/2C33H34NP/c2*1-24(2)29-20-13-21-30(25(3)4)33(29)34-35(27-15-7-5-8-16-27,28-17-9-6-10-18-28)32-23-22-26-14-11-12-19-31(26)32/h2*5-21,23-25H,22H2,1-4H3 |
| InChIKey | NQPIHDIHPZWLAC-UHFFFAOYSA-N |
| XLogP | 18.03 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 951.23 |
| LogP ≤ 5 | 18.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|