C39H49N2P — CID 5242446
N-[1-[[2,6-di(propan-2-yl)phenyl]imino-diphenyl-λ5-phosphanyl]prop-1-en-2-yl]-2,6-di(propan-2-yl)aniline (PubChem CID 5242446) has the molecular formula C39H49N2P and a molecular weight of 576.81 g/mol. Its IUPAC name is N-[1-[[2,6-di(propan-2-yl)phenyl]imino-diphenyl-λ5-phosphanyl]prop-1-en-2-yl]-2,6-di(propan-2-yl)aniline.
| Compound Name | N-[1-[[2,6-di(propan-2-yl)phenyl]imino-diphenyl-λ5-phosphanyl]prop-1-en-2-yl]-2,6-di(propan-2-yl)aniline |
|---|---|
| PubChem CID | 5242446 |
| Molecular Formula | C39H49N2P |
| Molecular Weight | 576.81 g/mol |
| Exact Mass | 576.36 |
| IUPAC Name | N-[1-[[2,6-di(propan-2-yl)phenyl]imino-diphenyl-λ5-phosphanyl]prop-1-en-2-yl]-2,6-di(propan-2-yl)aniline |
| SMILES | CC(=CP(=Nc1c(C(C)C)cccc1C(C)C)(c1ccccc1)c1ccccc1)Nc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C39H49N2P/c1-27(2)34-22-16-23-35(28(3)4)38(34)40-31(9)26-42(32-18-12-10-13-19-32,33-20-14-11-15-21-33)41-39-36(29(5)6)24-17-25-37(39)30(7)8/h10-30,40H,1-9H3 |
| InChIKey | OPWIMBODSCHBAR-UHFFFAOYSA-N |
| XLogP | 11.64 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.81 |
| LogP ≤ 5 | 11.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|