C29H44N2 — CID 12981045
(E)-2-N,4-N-bis[2,6-di(propan-2-yl)phenyl]pent-2-ene-2,4-diamine (PubChem CID 12981045) has the molecular formula C29H44N2 and a molecular weight of 420.69 g/mol. Its IUPAC name is (E)-2-N,4-N-bis[2,6-di(propan-2-yl)phenyl]pent-2-ene-2,4-diamine.
| Compound Name | (E)-2-N,4-N-bis[2,6-di(propan-2-yl)phenyl]pent-2-ene-2,4-diamine |
|---|---|
| PubChem CID | 12981045 |
| Molecular Formula | C29H44N2 |
| Molecular Weight | 420.69 g/mol |
| Exact Mass | 420.35 |
| IUPAC Name | (E)-2-N,4-N-bis[2,6-di(propan-2-yl)phenyl]pent-2-ene-2,4-diamine |
| SMILES | C/C(=C\C(C)Nc1c(C(C)C)cccc1C(C)C)Nc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C29H44N2/c1-18(2)24-13-11-14-25(19(3)4)28(24)30-22(9)17-23(10)31-29-26(20(5)6)15-12-16-27(29)21(7)8/h11-22,30-31H,1-10H3/b23-17+ |
| InChIKey | MPRXMVYSXVYHML-HAVVHWLPSA-N |
| XLogP | 9.00 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.69 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |