C33H37NP+ — CID 87626126
[(E)-2-[2,6-di(propan-2-yl)anilino]prop-1-enyl]-triphenylphosphanium (PubChem CID 87626126) has the molecular formula C33H37NP+ and a molecular weight of 478.64 g/mol. Its IUPAC name is [(E)-2-[2,6-di(propan-2-yl)anilino]prop-1-enyl]-triphenylphosphanium.
| Compound Name | [(E)-2-[2,6-di(propan-2-yl)anilino]prop-1-enyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 87626126 |
| Molecular Formula | C33H37NP+ |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | [(E)-2-[2,6-di(propan-2-yl)anilino]prop-1-enyl]-triphenylphosphanium |
| SMILES | C/C(=C\[P+](c1ccccc1)(c1ccccc1)c1ccccc1)Nc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C33H37NP/c1-25(2)31-22-15-23-32(26(3)4)33(31)34-27(5)24-35(28-16-9-6-10-17-28,29-18-11-7-12-19-29)30-20-13-8-14-21-30/h6-26,34H,1-5H3/q+1/b27-24+ |
| InChIKey | BHNHQHNHYQEJFQ-SOYKGTTHSA-N |
| XLogP | 8.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|