C34H45F6N2P — CID 139074004
[(E)-3-[2,6-di(propan-2-yl)anilino]-1-phenylbut-2-enylidene]-[2,6-di(propan-2-yl)phenyl]azanium hexafluorophosphate (PubChem CID 139074004) has the molecular formula C34H45F6N2P and a molecular weight of 626.71 g/mol. Its IUPAC name is [(E)-3-[2,6-di(propan-2-yl)anilino]-1-phenylbut-2-enylidene]-[2,6-di(propan-2-yl)phenyl]azanium hexafluorophosphate.
| Compound Name | [(E)-3-[2,6-di(propan-2-yl)anilino]-1-phenylbut-2-enylidene]-[2,6-di(propan-2-yl)phenyl]azanium hexafluorophosphate |
|---|---|
| PubChem CID | 139074004 |
| Molecular Formula | C34H45F6N2P |
| Molecular Weight | 626.71 g/mol |
| Exact Mass | 626.32 |
| IUPAC Name | [(E)-3-[2,6-di(propan-2-yl)anilino]-1-phenylbut-2-enylidene]-[2,6-di(propan-2-yl)phenyl]azanium hexafluorophosphate |
| SMILES | C/C(=C\C(=[NH+]/c1c(C(C)C)cccc1C(C)C)c1ccccc1)Nc1c(C(C)C)cccc1C(C)C.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C34H44N2.F6P/c1-22(2)28-17-13-18-29(23(3)4)33(28)35-26(9)21-32(27-15-11-10-12-16-27)36-34-30(24(5)6)19-14-20-31(34)25(7)8;1-7(2,3,4,5)6/h10-25,35H,1-9H3;/q;-1/p+1/b26-21+,36-32+; |
| InChIKey | QCESLIBKTKATKI-GORKELNMSA-O |
| XLogP | 11.78 |
| TPSA | 26.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.71 |
| LogP ≤ 5 | 11.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|