C27H33N3O5 — CID 58146363
ethyl 4-[[(1S,3R)-5-methoxy-2-adamantyl]amino]-5-nitro-6-(2-phenylethyl)pyridine-3-carboxylate (PubChem CID 58146363) has the molecular formula C27H33N3O5 and a molecular weight of 479.58 g/mol. Its IUPAC name is ethyl 4-[[(1S,3R)-5-methoxy-2-adamantyl]amino]-5-nitro-6-(2-phenylethyl)pyridine-3-carboxylate.
| Compound Name | ethyl 4-[[(1S,3R)-5-methoxy-2-adamantyl]amino]-5-nitro-6-(2-phenylethyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 58146363 |
| Molecular Formula | C27H33N3O5 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | ethyl 4-[[(1S,3R)-5-methoxy-2-adamantyl]amino]-5-nitro-6-(2-phenylethyl)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cnc(CCc2ccccc2)c([N+](=O)[O-])c1NC1[C@@H]2CC3C[C@H]1CC(OC)(C3)C2 |
| InChI | InChI=1S/C27H33N3O5/c1-3-35-26(31)21-16-28-22(10-9-17-7-5-4-6-8-17)25(30(32)33)24(21)29-23-19-11-18-12-20(23)15-27(13-18,14-19)34-2/h4-8,16,18-20,23H,3,9-15H2,1-2H3,(H,28,29)/t18?,19-,20+,23?,27? |
| InChIKey | AVPRJZQAYSZLPX-NIWPHFMXSA-N |
| XLogP | 4.96 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|