C25H30N4O4 — CID 58146683
3-[3-(3-hydroxy-1-adamantyl)-3,4,8-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-5-yl]-N-(2-methoxyethyl)-2-oxopropanamide (PubChem CID 58146683) has the molecular formula C25H30N4O4 and a molecular weight of 450.54 g/mol. Its IUPAC name is 3-[3-(3-hydroxy-1-adamantyl)-3,4,8-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-5-yl]-N-(2-methoxyethyl)-2-oxopropanamide.
| Compound Name | 3-[3-(3-hydroxy-1-adamantyl)-3,4,8-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-5-yl]-N-(2-methoxyethyl)-2-oxopropanamide |
|---|---|
| PubChem CID | 58146683 |
| Molecular Formula | C25H30N4O4 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | 3-[3-(3-hydroxy-1-adamantyl)-3,4,8-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-5-yl]-N-(2-methoxyethyl)-2-oxopropanamide |
| SMILES | COCCNC(=O)C(=O)Cc1nn(C23CC4CC(CC(O)(C4)C2)C3)c2c3c(ncc12)CC=C3 |
| InChI | InChI=1S/C25H30N4O4/c1-33-6-5-26-23(31)21(30)8-20-18-13-27-19-4-2-3-17(19)22(18)29(28-20)24-9-15-7-16(10-24)12-25(32,11-15)14-24/h2-3,13,15-16,32H,4-12,14H2,1H3,(H,26,31) |
| InChIKey | DIYIEPSCUUVABH-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|