C36H49N7O4 — CID 58149561
1-O-tert-butyl 4-O-(3-pyridin-4-ylpropyl) (2S)-2-[[[2,5-dimethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]methyl]butanedioate (PubChem CID 58149561) has the molecular formula C36H49N7O4 and a molecular weight of 643.83 g/mol. Its IUPAC name is 1-O-tert-butyl 4-O-(3-pyridin-4-ylpropyl) (2S)-2-[[[2,5-dimethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]methyl]butanedioate.
| Compound Name | 1-O-tert-butyl 4-O-(3-pyridin-4-ylpropyl) (2S)-2-[[[2,5-dimethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]methyl]butanedioate |
|---|---|
| PubChem CID | 58149561 |
| Molecular Formula | C36H49N7O4 |
| Molecular Weight | 643.83 g/mol |
| Exact Mass | 643.38 |
| IUPAC Name | 1-O-tert-butyl 4-O-(3-pyridin-4-ylpropyl) (2S)-2-[[[2,5-dimethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]methyl]butanedioate |
| SMILES | Cc1nc(NC[C@H](CC(=O)OCCCc2ccncc2)C(=O)OC(C)(C)C)c(C)c(N2CCC(c3ccc4c(n3)NCCC4)CC2)n1 |
| InChI | InChI=1S/C36H49N7O4/c1-24-32(39-23-29(35(45)47-36(3,4)5)22-31(44)46-21-7-8-26-12-17-37-18-13-26)40-25(2)41-34(24)43-19-14-27(15-20-43)30-11-10-28-9-6-16-38-33(28)42-30/h10-13,17-18,27,29H,6-9,14-16,19-23H2,1-5H3,(H,38,42)(H,39,40,41)/t29-/m0/s1 |
| InChIKey | MUNLNSQCKNEHMU-LJAQVGFWSA-N |
| XLogP | 5.56 |
| TPSA | 131.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.83 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|