About 2-(1-adamantyl)ethyl N-(4-bromophenyl)carbamate
2-(1-adamantyl)ethyl N-(4-bromophenyl)carbamate (PubChem CID 58149769) has the molecular formula C19H24BrNO2
and a molecular weight of 378.31 g/mol. Its IUPAC name is 2-(1-adamantyl)ethyl N-(4-bromophenyl)carbamate.
Molecular Properties
| Compound Name | 2-(1-adamantyl)ethyl N-(4-bromophenyl)carbamate |
| PubChem CID | 58149769 |
| Molecular Formula | C19H24BrNO2 |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 2-(1-adamantyl)ethyl N-(4-bromophenyl)carbamate |
| SMILES | O=C(Nc1ccc(Br)cc1)OCCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H24BrNO2/c20-16-1-3-17(4-2-16)21-18(22)23-6-5-19-10-13-7-14(11-19)9-15(8-13)12-19/h1-4,13-15H,5-12H2,(H,21,22) |
| InChIKey | MQOUPNRMHQWBNG-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1-adamantyl)ethyl N-(4-bromophenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-adamantyl)ethyl N-(4-bromophenyl)carbamate?
The IUPAC name of 2-(1-adamantyl)ethyl N-(4-bromophenyl)carbamate (CID 58149769) is 2-(1-adamantyl)ethyl N-(4-bromophenyl)carbamate.
What is the SMILES notation for 2-(1-adamantyl)ethyl N-(4-bromophenyl)carbamate?
The canonical SMILES for 2-(1-adamantyl)ethyl N-(4-bromophenyl)carbamate is O=C(Nc1ccc(Br)cc1)OCCC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 2-(1-adamantyl)ethyl N-(4-bromophenyl)carbamate?
The InChIKey is MQOUPNRMHQWBNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24BrNO2/c20-16-1-3-17(4-2-16)21-18(22)23-6-5-19-10-13-7-14(11-19)9-15(8-13)12-19/h1-4,13-15H,5-12H2,(H,21,22).
What are the key properties of 2-(1-adamantyl)ethyl N-(4-bromophenyl)carbamate?
2-(1-adamantyl)ethyl N-(4-bromophenyl)carbamate has a molecular weight of 378.31 g/mol, XLogP of 5.60, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-adamantyl)ethyl N-(4-bromophenyl)carbamate is sourced from PubChem (CID 58149769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).