C22H26O8S2 — CID 58152817
[3,4-dimethyl-5-(4-methylphenyl)sulfonyloxy-6-oxooxan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 58152817) has the molecular formula C22H26O8S2 and a molecular weight of 482.58 g/mol. Its IUPAC name is [3,4-dimethyl-5-(4-methylphenyl)sulfonyloxy-6-oxooxan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [3,4-dimethyl-5-(4-methylphenyl)sulfonyloxy-6-oxooxan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 58152817 |
| Molecular Formula | C22H26O8S2 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | [3,4-dimethyl-5-(4-methylphenyl)sulfonyloxy-6-oxooxan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2OC(=O)C(OS(=O)(=O)c3ccc(C)cc3)C(C)C2C)cc1 |
| InChI | InChI=1S/C22H26O8S2/c1-14-5-9-18(10-6-14)31(24,25)28-13-20-16(3)17(4)21(22(23)29-20)30-32(26,27)19-11-7-15(2)8-12-19/h5-12,16-17,20-21H,13H2,1-4H3 |
| InChIKey | QKOBJSHSOAQWST-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|