C28H25F2N3O2 — CID 58154511
2-[3-(difluoromethyl)phenyl]-N-[4-(morpholin-4-ylmethyl)phenyl]quinoline-8-carboxamide (PubChem CID 58154511) has the molecular formula C28H25F2N3O2 and a molecular weight of 473.52 g/mol. Its IUPAC name is 2-[3-(difluoromethyl)phenyl]-N-[4-(morpholin-4-ylmethyl)phenyl]quinoline-8-carboxamide.
| Compound Name | 2-[3-(difluoromethyl)phenyl]-N-[4-(morpholin-4-ylmethyl)phenyl]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 58154511 |
| Molecular Formula | C28H25F2N3O2 |
| Molecular Weight | 473.52 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | 2-[3-(difluoromethyl)phenyl]-N-[4-(morpholin-4-ylmethyl)phenyl]quinoline-8-carboxamide |
| SMILES | O=C(Nc1ccc(CN2CCOCC2)cc1)c1cccc2ccc(-c3cccc(C(F)F)c3)nc12 |
| InChI | InChI=1S/C28H25F2N3O2/c29-27(30)22-5-1-4-21(17-22)25-12-9-20-3-2-6-24(26(20)32-25)28(34)31-23-10-7-19(8-11-23)18-33-13-15-35-16-14-33/h1-12,17,27H,13-16,18H2,(H,31,34) |
| InChIKey | JCFFPPVUJXYNFY-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.52 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |