C14H13Cl2N3 — CID 58157415
5-tert-butyl-1-(2,4-dichlorophenyl)pyrazole-3-carbonitrile (PubChem CID 58157415) has the molecular formula C14H13Cl2N3 and a molecular weight of 294.19 g/mol. Its IUPAC name is 5-tert-butyl-1-(2,4-dichlorophenyl)pyrazole-3-carbonitrile.
| Compound Name | 5-tert-butyl-1-(2,4-dichlorophenyl)pyrazole-3-carbonitrile |
|---|---|
| PubChem CID | 58157415 |
| Molecular Formula | C14H13Cl2N3 |
| Molecular Weight | 294.19 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 5-tert-butyl-1-(2,4-dichlorophenyl)pyrazole-3-carbonitrile |
| SMILES | CC(C)(C)c1cc(C#N)nn1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H13Cl2N3/c1-14(2,3)13-7-10(8-17)18-19(13)12-5-4-9(15)6-11(12)16/h4-7H,1-3H3 |
| InChIKey | BNCZBEHVOCYLNM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.19 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |