C16H21ClN4O3S — CID 58158719
N-(3-chloro-4-hydroxyphenyl)sulfonyl-N'-ethyl-2,3-diazaspiro[4.4]non-3-ene-2-carboximidamide (PubChem CID 58158719) has the molecular formula C16H21ClN4O3S and a molecular weight of 384.89 g/mol. Its IUPAC name is N-(3-chloro-4-hydroxyphenyl)sulfonyl-N'-ethyl-2,3-diazaspiro[4.4]non-3-ene-2-carboximidamide.
| Compound Name | N-(3-chloro-4-hydroxyphenyl)sulfonyl-N'-ethyl-2,3-diazaspiro[4.4]non-3-ene-2-carboximidamide |
|---|---|
| PubChem CID | 58158719 |
| Molecular Formula | C16H21ClN4O3S |
| Molecular Weight | 384.89 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | N-(3-chloro-4-hydroxyphenyl)sulfonyl-N'-ethyl-2,3-diazaspiro[4.4]non-3-ene-2-carboximidamide |
| SMILES | CC/N=C(/NS(=O)(=O)c1ccc(O)c(Cl)c1)N1CC2(C=N1)CCCC2 |
| InChI | InChI=1S/C16H21ClN4O3S/c1-2-18-15(21-11-16(10-19-21)7-3-4-8-16)20-25(23,24)12-5-6-14(22)13(17)9-12/h5-6,9-10,22H,2-4,7-8,11H2,1H3,(H,18,20) |
| InChIKey | HUJIOLMFBKMOIZ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.89 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|