C33H42N4O3SSi — CID 70251808
N'-ethyl-N-[4-[3-[hydroxy(diphenyl)silyl]-3-methylbutyl]phenyl]sulfonyl-2,3-diazaspiro[4.4]non-3-ene-2-carboximidamide (PubChem CID 70251808) has the molecular formula C33H42N4O3SSi and a molecular weight of 602.88 g/mol. Its IUPAC name is N'-ethyl-N-[4-[3-[hydroxy(diphenyl)silyl]-3-methylbutyl]phenyl]sulfonyl-2,3-diazaspiro[4.4]non-3-ene-2-carboximidamide.
| Compound Name | N'-ethyl-N-[4-[3-[hydroxy(diphenyl)silyl]-3-methylbutyl]phenyl]sulfonyl-2,3-diazaspiro[4.4]non-3-ene-2-carboximidamide |
|---|---|
| PubChem CID | 70251808 |
| Molecular Formula | C33H42N4O3SSi |
| Molecular Weight | 602.88 g/mol |
| Exact Mass | 602.27 |
| IUPAC Name | N'-ethyl-N-[4-[3-[hydroxy(diphenyl)silyl]-3-methylbutyl]phenyl]sulfonyl-2,3-diazaspiro[4.4]non-3-ene-2-carboximidamide |
| SMILES | CC/N=C(\NS(=O)(=O)c1ccc(CCC(C)(C)[Si](O)(c2ccccc2)c2ccccc2)cc1)N1CC2(C=N1)CCCC2 |
| InChI | InChI=1S/C33H42N4O3SSi/c1-4-34-31(37-26-33(25-35-37)22-11-12-23-33)36-41(38,39)28-19-17-27(18-20-28)21-24-32(2,3)42(40,29-13-7-5-8-14-29)30-15-9-6-10-16-30/h5-10,13-20,25,40H,4,11-12,21-24,26H2,1-3H3,(H,34,36) |
| InChIKey | NOZVOCZZLNPXMI-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.88 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|