C21H10ClFN2SZn — CID 58163129
CID 58163129 (PubChem CID 58163129) has the molecular formula C21H10ClFN2SZn and a molecular weight of 442.23 g/mol.
| Compound Name | CID 58163129 |
|---|---|
| PubChem CID | 58163129 |
| Molecular Formula | C21H10ClFN2SZn |
| Molecular Weight | 442.23 g/mol |
| Exact Mass | 439.95 |
| IUPAC Name | — |
| SMILES | Cl[Zn+].Fc1c[c-]c2c(c1)c1ccccc1n1c2nc2c3ccccc3sc21 |
| InChI | InChI=1S/C21H10FN2S.ClH.Zn/c22-12-9-10-14-16(11-12)13-5-1-3-7-17(13)24-20(14)23-19-15-6-2-4-8-18(15)25-21(19)24;;/h1-9,11H;1H;/q-1;;+2/p-1 |
| InChIKey | RZQFGDQYJFVPBX-UHFFFAOYSA-M |
| XLogP | 6.63 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.23 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|