C19H24O4 — CID 58173607
(1,1,2,2,3,3,4,4-octadeuterio-4-methoxybutyl) (2S)-2,3,3,3-tetradeuterio-2-(1,3,4,5,7,8-hexadeuterio-6-methoxynaphthalen-2-yl)propanoate (PubChem CID 58173607) has the molecular formula C19H24O4 and a molecular weight of 334.51 g/mol. Its IUPAC name is (1,1,2,2,3,3,4,4-octadeuterio-4-methoxybutyl) (2S)-2,3,3,3-tetradeuterio-2-(1,3,4,5,7,8-hexadeuterio-6-methoxynaphthalen-2-yl)propanoate.
| Compound Name | (1,1,2,2,3,3,4,4-octadeuterio-4-methoxybutyl) (2S)-2,3,3,3-tetradeuterio-2-(1,3,4,5,7,8-hexadeuterio-6-methoxynaphthalen-2-yl)propanoate |
|---|---|
| PubChem CID | 58173607 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.28 |
| IUPAC Name | (1,1,2,2,3,3,4,4-octadeuterio-4-methoxybutyl) (2S)-2,3,3,3-tetradeuterio-2-(1,3,4,5,7,8-hexadeuterio-6-methoxynaphthalen-2-yl)propanoate |
| SMILES | [2H]c1c([C@@]([2H])(C(=O)OC([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])OC)C([2H])([2H])[2H])c([2H])c2c([2H])c([2H])c(OC)c([2H])c2c1[2H] |
| InChI | InChI=1S/C19H24O4/c1-14(19(20)23-11-5-4-10-21-2)15-6-7-17-13-18(22-3)9-8-16(17)12-15/h6-9,12-14H,4-5,10-11H2,1-3H3/t14-/m0/s1/i1D3,4D2,5D2,6D,7D,8D,9D,10D2,11D2,12D,13D,14D |
| InChIKey | CQVGYCXBXXGVSU-IXMMCVOQSA-N |
| XLogP | 3.92 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |