C23H21N3O5WY-2 — CID 58176106
[2-[3-[(3S)-4-carboxy-3-methanidyl-2-oxobutyl]-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl]acetyl]azanide;tungsten;yttrium (PubChem CID 58176106) has the molecular formula C23H21N3O5WY-2 and a molecular weight of 692.18 g/mol. Its IUPAC name is [2-[3-[(3S)-4-carboxy-3-methanidyl-2-oxobutyl]-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl]acetyl]azanide;tungsten;yttrium.
| Compound Name | [2-[3-[(3S)-4-carboxy-3-methanidyl-2-oxobutyl]-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl]acetyl]azanide;tungsten;yttrium |
|---|---|
| PubChem CID | 58176106 |
| Molecular Formula | C23H21N3O5WY-2 |
| Molecular Weight | 692.18 g/mol |
| Exact Mass | 692.01 |
| IUPAC Name | [2-[3-[(3S)-4-carboxy-3-methanidyl-2-oxobutyl]-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl]acetyl]azanide;tungsten;yttrium |
| SMILES | [CH2-][C@@H](CC(=O)O)C(=O)CC1N=C(c2ccccc2)c2ccccc2N(CC([NH-])=O)C1=O.[W].[Y] |
| InChI | InChI=1S/C23H22N3O5.W.Y/c1-14(11-21(29)30)19(27)12-17-23(31)26(13-20(24)28)18-10-6-5-9-16(18)22(25-17)15-7-3-2-4-8-15;;/h2-10,14,17H,1,11-13H2,(H3,24,28,29,30);;/q-1;;/p-1/t14-,17?;;/m0../s1 |
| InChIKey | VIBNWJMDLMOSRO-CFDFAACASA-M |
| XLogP | 2.70 |
| TPSA | 127.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.18 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|