C25H30N4O2 — CID 53306533
2-[(3R)-3-[(2-methylpropylamino)methyl]-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl]-N-prop-2-enylacetamide (PubChem CID 53306533) has the molecular formula C25H30N4O2 and a molecular weight of 418.54 g/mol. Its IUPAC name is 2-[(3R)-3-[(2-methylpropylamino)methyl]-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl]-N-prop-2-enylacetamide.
| Compound Name | 2-[(3R)-3-[(2-methylpropylamino)methyl]-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 53306533 |
| Molecular Formula | C25H30N4O2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | 2-[(3R)-3-[(2-methylpropylamino)methyl]-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CN1C(=O)[C@@H](CNCC(C)C)N=C(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C25H30N4O2/c1-4-14-27-23(30)17-29-22-13-9-8-12-20(22)24(19-10-6-5-7-11-19)28-21(25(29)31)16-26-15-18(2)3/h4-13,18,21,26H,1,14-17H2,2-3H3,(H,27,30)/t21-/m1/s1 |
| InChIKey | HCIFETDYPQAWRU-OAQYLSRUSA-N |
| XLogP | 2.79 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|