C29H34N4O6 — CID 66555496
ethyl (E)-4-[[2-[(3R)-3-(butylcarbamoyloxymethyl)-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl]acetyl]amino]but-2-enoate (PubChem CID 66555496) has the molecular formula C29H34N4O6 and a molecular weight of 534.61 g/mol. Its IUPAC name is ethyl (E)-4-[[2-[(3R)-3-(butylcarbamoyloxymethyl)-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl]acetyl]amino]but-2-enoate.
| Compound Name | ethyl (E)-4-[[2-[(3R)-3-(butylcarbamoyloxymethyl)-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl]acetyl]amino]but-2-enoate |
|---|---|
| PubChem CID | 66555496 |
| Molecular Formula | C29H34N4O6 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.25 |
| IUPAC Name | ethyl (E)-4-[[2-[(3R)-3-(butylcarbamoyloxymethyl)-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl]acetyl]amino]but-2-enoate |
| SMILES | CCCCNC(=O)OC[C@H]1N=C(c2ccccc2)c2ccccc2N(CC(=O)NC/C=C/C(=O)OCC)C1=O |
| InChI | InChI=1S/C29H34N4O6/c1-3-5-17-31-29(37)39-20-23-28(36)33(19-25(34)30-18-11-16-26(35)38-4-2)24-15-10-9-14-22(24)27(32-23)21-12-7-6-8-13-21/h6-16,23H,3-5,17-20H2,1-2H3,(H,30,34)(H,31,37)/b16-11+/t23-/m1/s1 |
| InChIKey | GQTAXJGNCZOXHV-UUFSLDAJSA-N |
| XLogP | 3.00 |
| TPSA | 126.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|