C29H29N3O3 — CID 24801058
2-[(3R)-3-(hydroxymethyl)-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl]-N-[(3S)-5-phenylpent-1-en-3-yl]acetamide (PubChem CID 24801058) has the molecular formula C29H29N3O3 and a molecular weight of 467.57 g/mol. Its IUPAC name is 2-[(3R)-3-(hydroxymethyl)-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl]-N-[(3S)-5-phenylpent-1-en-3-yl]acetamide.
| Compound Name | 2-[(3R)-3-(hydroxymethyl)-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl]-N-[(3S)-5-phenylpent-1-en-3-yl]acetamide |
|---|---|
| PubChem CID | 24801058 |
| Molecular Formula | C29H29N3O3 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 2-[(3R)-3-(hydroxymethyl)-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl]-N-[(3S)-5-phenylpent-1-en-3-yl]acetamide |
| SMILES | C=C[C@H](CCc1ccccc1)NC(=O)CN1C(=O)[C@@H](CO)N=C(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C29H29N3O3/c1-2-23(18-17-21-11-5-3-6-12-21)30-27(34)19-32-26-16-10-9-15-24(26)28(22-13-7-4-8-14-22)31-25(20-33)29(32)35/h2-16,23,25,33H,1,17-20H2,(H,30,34)/t23-,25-/m1/s1 |
| InChIKey | JIRBTNGEIWLVQU-ILBGXUMGSA-N |
| XLogP | 3.54 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|