C23H24O3S — CID 58184450
methyl 5-[3-[(1R,2S,3R)-3-methyl-5-oxo-2-(2-phenylethynyl)cyclopentyl]propyl]thiophene-2-carboxylate (PubChem CID 58184450) has the molecular formula C23H24O3S and a molecular weight of 380.51 g/mol. Its IUPAC name is methyl 5-[3-[(1R,2S,3R)-3-methyl-5-oxo-2-(2-phenylethynyl)cyclopentyl]propyl]thiophene-2-carboxylate.
| Compound Name | methyl 5-[3-[(1R,2S,3R)-3-methyl-5-oxo-2-(2-phenylethynyl)cyclopentyl]propyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 58184450 |
| Molecular Formula | C23H24O3S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | methyl 5-[3-[(1R,2S,3R)-3-methyl-5-oxo-2-(2-phenylethynyl)cyclopentyl]propyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(CCC[C@H]2C(=O)C[C@@H](C)[C@@H]2C#Cc2ccccc2)s1 |
| InChI | InChI=1S/C23H24O3S/c1-16-15-21(24)20(19(16)13-11-17-7-4-3-5-8-17)10-6-9-18-12-14-22(27-18)23(25)26-2/h3-5,7-8,12,14,16,19-20H,6,9-10,15H2,1-2H3/t16-,19+,20-/m1/s1 |
| InChIKey | YESWXHRADXVRCE-LSTHTHJFSA-N |
| XLogP | 4.75 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|