C28H31N — CID 58184992
10,10,14,14,15,15,22-heptamethyl-22-azapentacyclo[11.9.0.03,11.04,9.016,21]docosa-1(13),2,4,6,8,11,16,18,20-nonaene (PubChem CID 58184992) has the molecular formula C28H31N and a molecular weight of 381.56 g/mol. Its IUPAC name is 10,10,14,14,15,15,22-heptamethyl-22-azapentacyclo[11.9.0.03,11.04,9.016,21]docosa-1(13),2,4,6,8,11,16,18,20-nonaene.
| Compound Name | 10,10,14,14,15,15,22-heptamethyl-22-azapentacyclo[11.9.0.03,11.04,9.016,21]docosa-1(13),2,4,6,8,11,16,18,20-nonaene |
|---|---|
| PubChem CID | 58184992 |
| Molecular Formula | C28H31N |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | 10,10,14,14,15,15,22-heptamethyl-22-azapentacyclo[11.9.0.03,11.04,9.016,21]docosa-1(13),2,4,6,8,11,16,18,20-nonaene |
| SMILES | CN1c2ccccc2C(C)(C)C(C)(C)c2cc3c(cc21)-c1ccccc1C3(C)C |
| InChI | InChI=1S/C28H31N/c1-26(2)20-13-9-8-12-18(20)19-16-25-23(17-22(19)26)28(5,6)27(3,4)21-14-10-11-15-24(21)29(25)7/h8-17H,1-7H3 |
| InChIKey | BVECHVFEDOWWCA-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |