C12H9ClN4OS — CID 58190066
3-chloro-6-methyl-N-(4H-triazol-5-yl)-1-benzothiophene-2-carboxamide (PubChem CID 58190066) has the molecular formula C12H9ClN4OS and a molecular weight of 292.75 g/mol. Its IUPAC name is 3-chloro-6-methyl-N-(4H-triazol-5-yl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-6-methyl-N-(4H-triazol-5-yl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 58190066 |
| Molecular Formula | C12H9ClN4OS |
| Molecular Weight | 292.75 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | 3-chloro-6-methyl-N-(4H-triazol-5-yl)-1-benzothiophene-2-carboxamide |
| SMILES | Cc1ccc2c(Cl)c(C(=O)NC3=NN=NC3)sc2c1 |
| InChI | InChI=1S/C12H9ClN4OS/c1-6-2-3-7-8(4-6)19-11(10(7)13)12(18)15-9-5-14-17-16-9/h2-4H,5H2,1H3,(H,14,15,16,18) |
| InChIKey | ZGNARCCOCYMJAB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 66.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.75 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |