C16H14FN5O — CID 58191728
1-[1-(4-fluorophenyl)-5-methyltriazol-4-yl]-2-(6-methylpyrazin-2-yl)ethanone (PubChem CID 58191728) has the molecular formula C16H14FN5O and a molecular weight of 311.32 g/mol. Its IUPAC name is 1-[1-(4-fluorophenyl)-5-methyltriazol-4-yl]-2-(6-methylpyrazin-2-yl)ethanone.
| Compound Name | 1-[1-(4-fluorophenyl)-5-methyltriazol-4-yl]-2-(6-methylpyrazin-2-yl)ethanone |
|---|---|
| PubChem CID | 58191728 |
| Molecular Formula | C16H14FN5O |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 1-[1-(4-fluorophenyl)-5-methyltriazol-4-yl]-2-(6-methylpyrazin-2-yl)ethanone |
| SMILES | Cc1cncc(CC(=O)c2nnn(-c3ccc(F)cc3)c2C)n1 |
| InChI | InChI=1S/C16H14FN5O/c1-10-8-18-9-13(19-10)7-15(23)16-11(2)22(21-20-16)14-5-3-12(17)4-6-14/h3-6,8-9H,7H2,1-2H3 |
| InChIKey | LLNVHZZWFKNLTI-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 73.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |