C22H23N3O — CID 58198214
CID 58198214 (PubChem CID 58198214) has the molecular formula C22H23N3O and a molecular weight of 345.45 g/mol.
| Compound Name | CID 58198214 |
|---|---|
| PubChem CID | 58198214 |
| Molecular Formula | C22H23N3O |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | — |
| SMILES | CN1C(=O)[C@]2(N=C1N)c1ccccc1CC21CCc2ccccc2CC1 |
| InChI | InChI=1S/C22H23N3O/c1-25-19(26)22(24-20(25)23)18-9-5-4-8-17(18)14-21(22)12-10-15-6-2-3-7-16(15)11-13-21/h2-9H,10-14H2,1H3,(H2,23,24)/t22-/m1/s1 |
| InChIKey | NBARGRGEIIPREU-JOCHJYFZSA-N |
| XLogP | 2.79 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |