C19H21N3O — CID 44537035
2-amino-3-butyl-5,5-diphenylimidazol-4-one (PubChem CID 44537035) has the molecular formula C19H21N3O and a molecular weight of 307.40 g/mol. Its IUPAC name is 2-amino-3-butyl-5,5-diphenylimidazol-4-one.
| Compound Name | 2-amino-3-butyl-5,5-diphenylimidazol-4-one |
|---|---|
| PubChem CID | 44537035 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 2-amino-3-butyl-5,5-diphenylimidazol-4-one |
| SMILES | CCCCN1C(=O)C(c2ccccc2)(c2ccccc2)N=C1N |
| InChI | InChI=1S/C19H21N3O/c1-2-3-14-22-17(23)19(21-18(22)20,15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-13H,2-3,14H2,1H3,(H2,20,21) |
| InChIKey | WCSBYTCXMICQIU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |