C20H23N3O — CID 44530521
2-amino-3-(2,2-dimethylpropyl)-5,5-diphenylimidazol-4-one (PubChem CID 44530521) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is 2-amino-3-(2,2-dimethylpropyl)-5,5-diphenylimidazol-4-one.
| Compound Name | 2-amino-3-(2,2-dimethylpropyl)-5,5-diphenylimidazol-4-one |
|---|---|
| PubChem CID | 44530521 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 2-amino-3-(2,2-dimethylpropyl)-5,5-diphenylimidazol-4-one |
| SMILES | CC(C)(C)CN1C(=O)C(c2ccccc2)(c2ccccc2)N=C1N |
| InChI | InChI=1S/C20H23N3O/c1-19(2,3)14-23-17(24)20(22-18(23)21,15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-13H,14H2,1-3H3,(H2,21,22) |
| InChIKey | GQTSUQOPBVDUAA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |