C14H13NO5S — CID 58199966
methyl 3,3,5-trioxo-1,2,4,6-tetrahydrothiopyrano[3,4-c]quinoline-7-carboxylate (PubChem CID 58199966) has the molecular formula C14H13NO5S and a molecular weight of 307.33 g/mol. Its IUPAC name is methyl 3,3,5-trioxo-1,2,4,6-tetrahydrothiopyrano[3,4-c]quinoline-7-carboxylate.
| Compound Name | methyl 3,3,5-trioxo-1,2,4,6-tetrahydrothiopyrano[3,4-c]quinoline-7-carboxylate |
|---|---|
| PubChem CID | 58199966 |
| Molecular Formula | C14H13NO5S |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | methyl 3,3,5-trioxo-1,2,4,6-tetrahydrothiopyrano[3,4-c]quinoline-7-carboxylate |
| SMILES | COC(=O)c1cccc2c3c(c(=O)[nH]c12)CS(=O)(=O)CC3 |
| InChI | InChI=1S/C14H13NO5S/c1-20-14(17)10-4-2-3-9-8-5-6-21(18,19)7-11(8)13(16)15-12(9)10/h2-4H,5-7H2,1H3,(H,15,16) |
| InChIKey | SAGDPTQYBDOQRR-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |