C10H7F3N2O3S2 — CID 58200452
(5-methyl-2-pyridin-2-yl-1,3-thiazol-4-yl) trifluoromethanesulfonate (PubChem CID 58200452) has the molecular formula C10H7F3N2O3S2 and a molecular weight of 324.31 g/mol. Its IUPAC name is (5-methyl-2-pyridin-2-yl-1,3-thiazol-4-yl) trifluoromethanesulfonate.
| Compound Name | (5-methyl-2-pyridin-2-yl-1,3-thiazol-4-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 58200452 |
| Molecular Formula | C10H7F3N2O3S2 |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | (5-methyl-2-pyridin-2-yl-1,3-thiazol-4-yl) trifluoromethanesulfonate |
| SMILES | Cc1sc(-c2ccccn2)nc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H7F3N2O3S2/c1-6-8(18-20(16,17)10(11,12)13)15-9(19-6)7-4-2-3-5-14-7/h2-5H,1H3 |
| InChIKey | OUMDHGHNZJOTMZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|