C19H30BrNO2 — CID 58201343
tert-butyl 7-(6-bromo-2-pyridinyl)-2,2-dimethyloctanoate (PubChem CID 58201343) has the molecular formula C19H30BrNO2 and a molecular weight of 384.36 g/mol. Its IUPAC name is tert-butyl 7-(6-bromo-2-pyridinyl)-2,2-dimethyloctanoate.
| Compound Name | tert-butyl 7-(6-bromo-2-pyridinyl)-2,2-dimethyloctanoate |
|---|---|
| PubChem CID | 58201343 |
| Molecular Formula | C19H30BrNO2 |
| Molecular Weight | 384.36 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | tert-butyl 7-(6-bromo-2-pyridinyl)-2,2-dimethyloctanoate |
| SMILES | CC(CCCCC(C)(C)C(=O)OC(C)(C)C)c1cccc(Br)n1 |
| InChI | InChI=1S/C19H30BrNO2/c1-14(15-11-9-12-16(20)21-15)10-7-8-13-19(5,6)17(22)23-18(2,3)4/h9,11-12,14H,7-8,10,13H2,1-6H3 |
| InChIKey | PXABJJGZNQSXPP-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.36 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|