C14H18N4O6 — CID 58201775
(E)-2-(3-tert-butyl-2,4,6-trinitrophenyl)-N,N-dimethylethenamine (PubChem CID 58201775) has the molecular formula C14H18N4O6 and a molecular weight of 338.32 g/mol. Its IUPAC name is (E)-2-(3-tert-butyl-2,4,6-trinitrophenyl)-N,N-dimethylethenamine.
| Compound Name | (E)-2-(3-tert-butyl-2,4,6-trinitrophenyl)-N,N-dimethylethenamine |
|---|---|
| PubChem CID | 58201775 |
| Molecular Formula | C14H18N4O6 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | (E)-2-(3-tert-butyl-2,4,6-trinitrophenyl)-N,N-dimethylethenamine |
| SMILES | CN(C)/C=C/c1c([N+](=O)[O-])cc([N+](=O)[O-])c(C(C)(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H18N4O6/c1-14(2,3)12-11(17(21)22)8-10(16(19)20)9(6-7-15(4)5)13(12)18(23)24/h6-8H,1-5H3/b7-6+ |
| InChIKey | VXUAFXJOIZACRJ-VOTSOKGWSA-N |
| XLogP | 3.24 |
| TPSA | 132.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|