C24H25FN2O6 — CID 58201780
benzyl 2-[1-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-6-fluoro-5-nitroindol-2-yl]propanoate (PubChem CID 58201780) has the molecular formula C24H25FN2O6 and a molecular weight of 456.47 g/mol. Its IUPAC name is benzyl 2-[1-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-6-fluoro-5-nitroindol-2-yl]propanoate.
| Compound Name | benzyl 2-[1-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-6-fluoro-5-nitroindol-2-yl]propanoate |
|---|---|
| PubChem CID | 58201780 |
| Molecular Formula | C24H25FN2O6 |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | benzyl 2-[1-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-6-fluoro-5-nitroindol-2-yl]propanoate |
| SMILES | CC(C(=O)OCc1ccccc1)c1cc2cc([N+](=O)[O-])c(F)cc2n1C[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C24H25FN2O6/c1-15(23(28)31-13-16-7-5-4-6-8-16)20-9-17-10-22(27(29)30)19(25)11-21(17)26(20)12-18-14-32-24(2,3)33-18/h4-11,15,18H,12-14H2,1-3H3/t15?,18-/m1/s1 |
| InChIKey | FCOKSYWQDSPPAZ-KPMSDPLLSA-N |
| XLogP | 4.69 |
| TPSA | 92.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|