C24H31FN2O8 — CID 175065870
(2,2-dimethyl-1,3-dioxolan-4-yl) (2S)-2-[1-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-6-fluoro-5-nitroindol-2-yl]-2-methylbutanoate (PubChem CID 175065870) has the molecular formula C24H31FN2O8 and a molecular weight of 494.52 g/mol. Its IUPAC name is (2,2-dimethyl-1,3-dioxolan-4-yl) (2S)-2-[1-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-6-fluoro-5-nitroindol-2-yl]-2-methylbutanoate.
| Compound Name | (2,2-dimethyl-1,3-dioxolan-4-yl) (2S)-2-[1-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-6-fluoro-5-nitroindol-2-yl]-2-methylbutanoate |
|---|---|
| PubChem CID | 175065870 |
| Molecular Formula | C24H31FN2O8 |
| Molecular Weight | 494.52 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | (2,2-dimethyl-1,3-dioxolan-4-yl) (2S)-2-[1-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-6-fluoro-5-nitroindol-2-yl]-2-methylbutanoate |
| SMILES | CC[C@](C)(C(=O)OC1COC(C)(C)O1)c1cc2cc([N+](=O)[O-])c(F)cc2n1C[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C24H31FN2O8/c1-7-24(6,21(28)33-20-13-32-23(4,5)35-20)19-9-14-8-18(27(29)30)16(25)10-17(14)26(19)11-15-12-31-22(2,3)34-15/h8-10,15,20H,7,11-13H2,1-6H3/t15-,20?,24+/m1/s1 |
| InChIKey | VQQPFIHPXAMQCT-OYBOJAEASA-N |
| XLogP | 4.16 |
| TPSA | 111.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|