C21H21ClO4 — CID 58202549
1-(4-chlorophenyl)-5-(4-hydroxy-3-methoxyphenyl)-1-prop-2-ynoxypentan-2-one (PubChem CID 58202549) has the molecular formula C21H21ClO4 and a molecular weight of 372.85 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5-(4-hydroxy-3-methoxyphenyl)-1-prop-2-ynoxypentan-2-one.
| Compound Name | 1-(4-chlorophenyl)-5-(4-hydroxy-3-methoxyphenyl)-1-prop-2-ynoxypentan-2-one |
|---|---|
| PubChem CID | 58202549 |
| Molecular Formula | C21H21ClO4 |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 1-(4-chlorophenyl)-5-(4-hydroxy-3-methoxyphenyl)-1-prop-2-ynoxypentan-2-one |
| SMILES | C#CCOC(C(=O)CCCc1ccc(O)c(OC)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H21ClO4/c1-3-13-26-21(16-8-10-17(22)11-9-16)19(24)6-4-5-15-7-12-18(23)20(14-15)25-2/h1,7-12,14,21,23H,4-6,13H2,2H3 |
| InChIKey | VOIWCLSMKBDJQR-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|