C6H12N2O2 — CID 58204442
(2S,3S)-3-methoxypyrrolidine-2-carboxamide (PubChem CID 58204442) has the molecular formula C6H12N2O2 and a molecular weight of 144.17 g/mol. Its IUPAC name is (2S,3S)-3-methoxypyrrolidine-2-carboxamide.
| Compound Name | (2S,3S)-3-methoxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 58204442 |
| Molecular Formula | C6H12N2O2 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | (2S,3S)-3-methoxypyrrolidine-2-carboxamide |
| SMILES | CO[C@H]1CCN[C@@H]1C(N)=O |
| InChI | InChI=1S/C6H12N2O2/c1-10-4-2-3-8-5(4)6(7)9/h4-5,8H,2-3H2,1H3,(H2,7,9)/t4-,5-/m0/s1 |
| InChIKey | HJCKWYSJIHOPCL-WHFBIAKZSA-N |
| XLogP | -1.15 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |