C12H20OS2 — CID 58210266
2,3-dimethyl-5-(2-methyl-1,3-dithiolan-2-yl)-7-oxabicyclo[2.2.1]heptane (PubChem CID 58210266) has the molecular formula C12H20OS2 and a molecular weight of 244.42 g/mol. Its IUPAC name is 2,3-dimethyl-5-(2-methyl-1,3-dithiolan-2-yl)-7-oxabicyclo[2.2.1]heptane.
| Compound Name | 2,3-dimethyl-5-(2-methyl-1,3-dithiolan-2-yl)-7-oxabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 58210266 |
| Molecular Formula | C12H20OS2 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 2,3-dimethyl-5-(2-methyl-1,3-dithiolan-2-yl)-7-oxabicyclo[2.2.1]heptane |
| SMILES | CC1C2CC(C3(C)SCCS3)C(O2)C1C |
| InChI | InChI=1S/C12H20OS2/c1-7-8(2)11-9(6-10(7)13-11)12(3)14-4-5-15-12/h7-11H,4-6H2,1-3H3 |
| InChIKey | SGPGTGGBSKBJSK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |